C20H20Cl2N4O — CID 154687791
N-[2-[1-[2-(3,4-dichlorophenyl)ethyl]triazol-4-yl]propan-2-yl]benzamide (PubChem CID 154687791) has the molecular formula C20H20Cl2N4O and a molecular weight of 403.31 g/mol. Its IUPAC name is N-[2-[1-[2-(3,4-dichlorophenyl)ethyl]triazol-4-yl]propan-2-yl]benzamide.
| Compound Name | N-[2-[1-[2-(3,4-dichlorophenyl)ethyl]triazol-4-yl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 154687791 |
| Molecular Formula | C20H20Cl2N4O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[2-[1-[2-(3,4-dichlorophenyl)ethyl]triazol-4-yl]propan-2-yl]benzamide |
| SMILES | CC(C)(NC(=O)c1ccccc1)c1cn(CCc2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C20H20Cl2N4O/c1-20(2,23-19(27)15-6-4-3-5-7-15)18-13-26(25-24-18)11-10-14-8-9-16(21)17(22)12-14/h3-9,12-13H,10-11H2,1-2H3,(H,23,27) |
| InChIKey | LAKXVRNBCJGDFO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |