C12H14F2N4O3 — CID 162376575
methyl 1-(4-carbamoyl-5-fluoropyrimidin-2-yl)-4-fluoropiperidine-4-carboxylate (PubChem CID 162376575) has the molecular formula C12H14F2N4O3 and a molecular weight of 300.26 g/mol. Its IUPAC name is methyl 1-(4-carbamoyl-5-fluoropyrimidin-2-yl)-4-fluoropiperidine-4-carboxylate.
| Compound Name | methyl 1-(4-carbamoyl-5-fluoropyrimidin-2-yl)-4-fluoropiperidine-4-carboxylate |
|---|---|
| PubChem CID | 162376575 |
| Molecular Formula | C12H14F2N4O3 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 1-(4-carbamoyl-5-fluoropyrimidin-2-yl)-4-fluoropiperidine-4-carboxylate |
| SMILES | COC(=O)C1(F)CCN(c2ncc(F)c(C(N)=O)n2)CC1 |
| InChI | InChI=1S/C12H14F2N4O3/c1-21-10(20)12(14)2-4-18(5-3-12)11-16-6-7(13)8(17-11)9(15)19/h6H,2-5H2,1H3,(H2,15,19) |
| InChIKey | QDSGDRXMFPGCIG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |