C16H27N3O2 — CID 162376618
1-(2,5-dimethylpyrimidin-4-yl)ethenamine;2-propylpentanoic acid (PubChem CID 162376618) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrimidin-4-yl)ethenamine;2-propylpentanoic acid.
| Compound Name | 1-(2,5-dimethylpyrimidin-4-yl)ethenamine;2-propylpentanoic acid |
|---|---|
| PubChem CID | 162376618 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-(2,5-dimethylpyrimidin-4-yl)ethenamine;2-propylpentanoic acid |
| SMILES | C=C(N)c1nc(C)ncc1C.CCCC(CCC)C(=O)O |
| InChI | InChI=1S/C8H11N3.C8H16O2/c1-5-4-10-7(3)11-8(5)6(2)9;1-3-5-7(6-4-2)8(9)10/h4H,2,9H2,1,3H3;7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | ADOUMYZQGDNNIZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |