C13H21NO3 — CID 162379618
tert-butyl 2,2,6,6-tetradeuterio-4-prop-2-ynoxypiperidine-1-carboxylate (PubChem CID 162379618) has the molecular formula C13H21NO3 and a molecular weight of 243.34 g/mol. Its IUPAC name is tert-butyl 2,2,6,6-tetradeuterio-4-prop-2-ynoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 2,2,6,6-tetradeuterio-4-prop-2-ynoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162379618 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl 2,2,6,6-tetradeuterio-4-prop-2-ynoxypiperidine-1-carboxylate |
| SMILES | [2H]C1([2H])CC(OCC#C)CC([2H])([2H])N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO3/c1-5-10-16-11-6-8-14(9-7-11)12(15)17-13(2,3)4/h1,11H,6-10H2,2-4H3/i8D2,9D2 |
| InChIKey | BDDNPHOMXFFAAI-LZMSFWOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|