C24H27FN7O3Si — CID 162380849
CID 162380849 (PubChem CID 162380849) has the molecular formula C24H27FN7O3Si and a molecular weight of 508.61 g/mol.
| Compound Name | CID 162380849 |
|---|---|
| PubChem CID | 162380849 |
| Molecular Formula | C24H27FN7O3Si |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[Si](n2nc(C#Cc3cc4ncn(CC)c4cc3F)c(C(N)=O)c2NC)C[C@@H]1COC |
| InChI | InChI=1S/C24H27FN7O3Si/c1-5-21(33)31-14-36(12-16(31)11-35-4)32-24(27-3)22(23(26)34)18(29-32)8-7-15-9-19-20(10-17(15)25)30(6-2)13-28-19/h5,9-10,13,16,27H,1,6,11-12,14H2,2-4H3,(H2,26,34)/t16-/m0/s1 |
| InChIKey | HKIJTGXVJOYCBM-INIZCTEOSA-N |
| XLogP | 1.35 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|