C26H29ClN7O3Si — CID 162380655
CID 162380655 (PubChem CID 162380655) has the molecular formula C26H29ClN7O3Si and a molecular weight of 551.10 g/mol.
| Compound Name | CID 162380655 |
|---|---|
| PubChem CID | 162380655 |
| Molecular Formula | C26H29ClN7O3Si |
| Molecular Weight | 551.10 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[C@@]([Si])(n2nc(C#Cc3cc4nc(C)n(CC)c4cc3Cl)c(C(N)=O)c2NC)C[C@@H]1COC |
| InChI | InChI=1S/C26H29ClN7O3Si/c1-6-22(35)33-14-26(38,12-17(33)13-37-5)34-25(29-4)23(24(28)36)19(31-34)9-8-16-10-20-21(11-18(16)27)32(7-2)15(3)30-20/h6,10-11,17,29H,1,7,12-14H2,2-5H3,(H2,28,36)/t17-,26-/m1/s1 |
| InChIKey | YBPVWYNGSBEETM-WGDIFIGCSA-N |
| XLogP | 2.01 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.10 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|