C25H25ClN7O3Si — CID 162380947
CID 162380947 (PubChem CID 162380947) has the molecular formula C25H25ClN7O3Si and a molecular weight of 535.06 g/mol.
| Compound Name | CID 162380947 |
|---|---|
| PubChem CID | 162380947 |
| Molecular Formula | C25H25ClN7O3Si |
| Molecular Weight | 535.06 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[C@@]([Si])(n2nc(C#Cc3cc4ncn(C5CC5)c4cc3Cl)c(C(N)=O)c2NC)C[C@@H]1CO |
| InChI | InChI=1S/C25H25ClN7O3Si/c1-3-21(35)31-12-25(37,10-16(31)11-34)33-24(28-2)22(23(27)36)18(30-33)7-4-14-8-19-20(9-17(14)26)32(13-29-19)15-5-6-15/h3,8-9,13,15-16,28,34H,1,5-6,10-12H2,2H3,(H2,27,36)/t16-,25-/m1/s1 |
| InChIKey | DJVJUSFPABAWCN-PUAOIOHZSA-N |
| XLogP | 1.36 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.06 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|