C10H13N5O — CID 162381256
1-(azetidin-3-yl)-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 162381256) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 1-(azetidin-3-yl)-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381256 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-(azetidin-3-yl)-3-ethynyl-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C#Cc1nn(C2CNC2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C10H13N5O/c1-3-7-8(9(11)16)10(12-2)15(14-7)6-4-13-5-6/h1,6,12-13H,4-5H2,2H3,(H2,11,16) |
| InChIKey | NKSOBAVQPXVBLL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|