C26H31ClN6O3 — CID 162381260
(E)-3-amino-5-(6-chloro-3-methylquinolin-7-yl)-2-(N'-methylcarbamimidoyl)pent-2-en-4-ynamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 162381260) has the molecular formula C26H31ClN6O3 and a molecular weight of 511.03 g/mol. Its IUPAC name is (E)-3-amino-5-(6-chloro-3-methylquinolin-7-yl)-2-(N'-methylcarbamimidoyl)pent-2-en-4-ynamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-amino-5-(6-chloro-3-methylquinolin-7-yl)-2-(N'-methylcarbamimidoyl)pent-2-en-4-ynamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162381260 |
| Molecular Formula | C26H31ClN6O3 |
| Molecular Weight | 511.03 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (E)-3-amino-5-(6-chloro-3-methylquinolin-7-yl)-2-(N'-methylcarbamimidoyl)pent-2-en-4-ynamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C/N=C(N)/C(C(N)=O)=C(\N)C#Cc1cc2ncc(C)cc2cc1Cl.C=CC(=O)N1CCCC1COC |
| InChI | InChI=1S/C17H16ClN5O.C9H15NO2/c1-9-5-11-6-12(18)10(7-14(11)23-8-9)3-4-13(19)15(17(21)24)16(20)22-2;1-3-9(11)10-6-4-5-8(10)7-12-2/h5-8H,19H2,1-2H3,(H2,20,22)(H2,21,24);3,8H,1,4-7H2,2H3/b15-13+; |
| InChIKey | RIOJHSPODBBRAY-GVYCEHEKSA-N |
| XLogP | 2.04 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.03 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|