C34H44O2 — CID 162382712
(3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-hydroxy-3-(4-phenylphenyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 162382712) has the molecular formula C34H44O2 and a molecular weight of 484.72 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-hydroxy-3-(4-phenylphenyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-hydroxy-3-(4-phenylphenyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 162382712 |
| Molecular Formula | C34H44O2 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-hydroxy-3-(4-phenylphenyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2[C@H](O)CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H44O2/c1-33-20-18-27(35)22-26(33)13-14-28-29-15-16-31(34(29,2)21-19-30(28)33)32(36)17-10-23-8-11-25(12-9-23)24-6-4-3-5-7-24/h3-9,11-13,27-32,35-36H,10,14-22H2,1-2H3/t27-,28-,29-,30-,31+,32+,33-,34-/m0/s1 |
| InChIKey | AZHIUHVPVLEAIA-FUDPRXSLSA-N |
| XLogP | 7.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|