C15H9F5INO — CID 162383488
5,5-difluoro-3-iodo-1-[4-(trifluoromethyl)phenyl]-6,7-dihydroindol-4-one (PubChem CID 162383488) has the molecular formula C15H9F5INO and a molecular weight of 441.14 g/mol. Its IUPAC name is 5,5-difluoro-3-iodo-1-[4-(trifluoromethyl)phenyl]-6,7-dihydroindol-4-one.
| Compound Name | 5,5-difluoro-3-iodo-1-[4-(trifluoromethyl)phenyl]-6,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 162383488 |
| Molecular Formula | C15H9F5INO |
| Molecular Weight | 441.14 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | 5,5-difluoro-3-iodo-1-[4-(trifluoromethyl)phenyl]-6,7-dihydroindol-4-one |
| SMILES | O=C1c2c(I)cn(-c3ccc(C(F)(F)F)cc3)c2CCC1(F)F |
| InChI | InChI=1S/C15H9F5INO/c16-14(17)6-5-11-12(13(14)23)10(21)7-22(11)9-3-1-8(2-4-9)15(18,19)20/h1-4,7H,5-6H2 |
| InChIKey | PGJNPMOXOZCQJA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.14 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|