About 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol
5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol (PubChem CID 162383431) has the molecular formula C14H11F5N2O
and a molecular weight of 318.25 g/mol. Its IUPAC name is 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol.
Molecular Properties
| Compound Name | 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol |
| PubChem CID | 162383431 |
| Molecular Formula | C14H11F5N2O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol |
| SMILES | OC1c2c(C(F)(F)F)cn(-c3ccncc3)c2CCC1(F)F |
| InChI | InChI=1S/C14H11F5N2O/c15-13(16)4-1-10-11(12(13)22)9(14(17,18)19)7-21(10)8-2-5-20-6-3-8/h2-3,5-7,12,22H,1,4H2 |
| InChIKey | JOTYLYOHFYNKJK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
The IUPAC name of 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol (CID 162383431) is 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol.
What is the SMILES notation for 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
The canonical SMILES for 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol is OC1c2c(C(F)(F)F)cn(-c3ccncc3)c2CCC1(F)F.
What is the InChIKey of 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
The InChIKey is JOTYLYOHFYNKJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F5N2O/c15-13(16)4-1-10-11(12(13)22)9(14(17,18)19)7-21(10)8-2-5-20-6-3-8/h2-3,5-7,12,22H,1,4H2.
What are the key properties of 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol has a molecular weight of 318.25 g/mol, XLogP of 3.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-1-pyridin-4-yl-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol is sourced from PubChem (CID 162383431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).