C15H12ClF5N2O3 — CID 168842264
1-(4-chloro-1-nitrocyclohexa-2,4-dien-1-yl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol (PubChem CID 168842264) has the molecular formula C15H12ClF5N2O3 and a molecular weight of 398.72 g/mol. Its IUPAC name is 1-(4-chloro-1-nitrocyclohexa-2,4-dien-1-yl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol.
| Compound Name | 1-(4-chloro-1-nitrocyclohexa-2,4-dien-1-yl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 168842264 |
| Molecular Formula | C15H12ClF5N2O3 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-(4-chloro-1-nitrocyclohexa-2,4-dien-1-yl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol |
| SMILES | O=[N+]([O-])C1(n2cc(C(F)(F)F)c3c2CCC(F)(F)C3O)C=CC(Cl)=CC1 |
| InChI | InChI=1S/C15H12ClF5N2O3/c16-8-1-4-13(5-2-8,23(25)26)22-7-9(15(19,20)21)11-10(22)3-6-14(17,18)12(11)24/h1-2,4,7,12,24H,3,5-6H2 |
| InChIKey | KGRHKDNYKSFIMS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|