C13H22F2N2 — CID 162383688
6-[3-(2,2-difluoropropylamino)propyl]-6-methylcyclohexa-2,4-dien-1-amine (PubChem CID 162383688) has the molecular formula C13H22F2N2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 6-[3-(2,2-difluoropropylamino)propyl]-6-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 6-[3-(2,2-difluoropropylamino)propyl]-6-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 162383688 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 6-[3-(2,2-difluoropropylamino)propyl]-6-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CC(F)(F)CNCCCC1(C)C=CC=CC1N |
| InChI | InChI=1S/C13H22F2N2/c1-12(7-4-3-6-11(12)16)8-5-9-17-10-13(2,14)15/h3-4,6-7,11,17H,5,8-10,16H2,1-2H3 |
| InChIKey | JJIMTNHZOULNOM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|