C19H21N3O2 — CID 162385833
benzene;3,4-dihydropyrazol-2-yl-(3-phenoxyazetidin-1-yl)methanone (PubChem CID 162385833) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is benzene;3,4-dihydropyrazol-2-yl-(3-phenoxyazetidin-1-yl)methanone.
| Compound Name | benzene;3,4-dihydropyrazol-2-yl-(3-phenoxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 162385833 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | benzene;3,4-dihydropyrazol-2-yl-(3-phenoxyazetidin-1-yl)methanone |
| SMILES | O=C(N1CC(Oc2ccccc2)C1)N1CCC=N1.c1ccccc1 |
| InChI | InChI=1S/C13H15N3O2.C6H6/c17-13(16-8-4-7-14-16)15-9-12(10-15)18-11-5-2-1-3-6-11;1-2-4-6-5-3-1/h1-3,5-7,12H,4,8-10H2;1-6H |
| InChIKey | DMDCDIMTPFKWDK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |