C15H15FN6O — CID 162386398
3-(4-amino-3-fluorophenyl)-1-(oxolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 162386398) has the molecular formula C15H15FN6O and a molecular weight of 314.32 g/mol. Its IUPAC name is 3-(4-amino-3-fluorophenyl)-1-(oxolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-amino-3-fluorophenyl)-1-(oxolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 162386398 |
| Molecular Formula | C15H15FN6O |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(4-amino-3-fluorophenyl)-1-(oxolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ccc(-c2nn(C3CCOC3)c3ncnc(N)c23)cc1F |
| InChI | InChI=1S/C15H15FN6O/c16-10-5-8(1-2-11(10)17)13-12-14(18)19-7-20-15(12)22(21-13)9-3-4-23-6-9/h1-2,5,7,9H,3-4,6,17H2,(H2,18,19,20) |
| InChIKey | YAAMWWKJCNZYLV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|