C13H18IrN3O2S- — CID 162387833
[(E)-3-amino-4-oxo-4-(2-phenylethylamino)but-2-enoyl]azanide;iridium;methanethiol (PubChem CID 162387833) has the molecular formula C13H18IrN3O2S- and a molecular weight of 472.59 g/mol. Its IUPAC name is [(E)-3-amino-4-oxo-4-(2-phenylethylamino)but-2-enoyl]azanide;iridium;methanethiol.
| Compound Name | [(E)-3-amino-4-oxo-4-(2-phenylethylamino)but-2-enoyl]azanide;iridium;methanethiol |
|---|---|
| PubChem CID | 162387833 |
| Molecular Formula | C13H18IrN3O2S- |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [(E)-3-amino-4-oxo-4-(2-phenylethylamino)but-2-enoyl]azanide;iridium;methanethiol |
| SMILES | CS.[Ir].[NH-]C(=O)/C=C(/N)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C12H15N3O2.CH4S.Ir/c13-10(8-11(14)16)12(17)15-7-6-9-4-2-1-3-5-9;1-2;/h1-5,8H,6-7H2,(H5,13,14,15,16,17);2H,1H3;/p-1 |
| InChIKey | KJOPMERGOCQCMC-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|