C17H29N5O3 — CID 162387908
(2R)-N-(2-imidazol-1-ylethyl)-2-(octanoylamino)butanediamide (PubChem CID 162387908) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2R)-N-(2-imidazol-1-ylethyl)-2-(octanoylamino)butanediamide.
| Compound Name | (2R)-N-(2-imidazol-1-ylethyl)-2-(octanoylamino)butanediamide |
|---|---|
| PubChem CID | 162387908 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (2R)-N-(2-imidazol-1-ylethyl)-2-(octanoylamino)butanediamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C17H29N5O3/c1-2-3-4-5-6-7-16(24)21-14(12-15(18)23)17(25)20-9-11-22-10-8-19-13-22/h8,10,13-14H,2-7,9,11-12H2,1H3,(H2,18,23)(H,20,25)(H,21,24)/t14-/m1/s1 |
| InChIKey | CZEXMEBEZLTSTM-CQSZACIVSA-N |
| XLogP | 0.72 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|