C11H10BrF2NO — CID 162389403
4-bromo-5-fluoro-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methoxyaniline (PubChem CID 162389403) has the molecular formula C11H10BrF2NO and a molecular weight of 290.11 g/mol. Its IUPAC name is 4-bromo-5-fluoro-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methoxyaniline.
| Compound Name | 4-bromo-5-fluoro-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methoxyaniline |
|---|---|
| PubChem CID | 162389403 |
| Molecular Formula | C11H10BrF2NO |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 4-bromo-5-fluoro-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methoxyaniline |
| SMILES | C=C(/C=C/F)Nc1cc(F)c(Br)cc1OC |
| InChI | InChI=1S/C11H10BrF2NO/c1-7(3-4-13)15-10-6-9(14)8(12)5-11(10)16-2/h3-6,15H,1H2,2H3/b4-3+ |
| InChIKey | OCWDQGWREUTSCX-ONEGZZNKSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|