C24H43N2O5P — CID 162391206
2-azaniumylethyl 2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl phosphate (PubChem CID 162391206) has the molecular formula C24H43N2O5P and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-azaniumylethyl 2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl phosphate.
| Compound Name | 2-azaniumylethyl 2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl phosphate |
|---|---|
| PubChem CID | 162391206 |
| Molecular Formula | C24H43N2O5P |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 2-azaniumylethyl 2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCOP(=O)([O-])OCC[NH3+] |
| InChI | InChI=1S/C24H43N2O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27)26-21-23-31-32(28,29)30-22-20-25/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-23,25H2,1H3,(H,26,27)(H,28,29)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | GCGAVFMCCUPVIT-DOFZRALJSA-N |
| XLogP | 3.99 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|