(7-hydroxyisoquinolin-6-yl)boronic acid

C9H8BNO3 — CID 162391465

IUPAC(7-hydroxyisoquinolin-6-yl)boronic acid
SMILESOB(O)c1cc2ccncc2cc1O
InChIInChI=1S/C9H8BNO3/c12-9-4-7-5-11-2-1-6(7)3-8(9)10(13)14/h1-5,12-14H
InChIKeyQYOQOBWVCWZPGT-UHFFFAOYSA-N
MW188.98 g/mol
LogP-0.38
Rot. Bonds1

About (7-hydroxyisoquinolin-6-yl)boronic acid

(7-hydroxyisoquinolin-6-yl)boronic acid (PubChem CID 162391465) has the molecular formula C9H8BNO3 and a molecular weight of 188.98 g/mol. Its IUPAC name is (7-hydroxyisoquinolin-6-yl)boronic acid.

Molecular Properties

Compound Name(7-hydroxyisoquinolin-6-yl)boronic acid
PubChem CID162391465
Molecular FormulaC9H8BNO3
Molecular Weight188.98 g/mol
Exact Mass189.06
IUPAC Name(7-hydroxyisoquinolin-6-yl)boronic acid
SMILESOB(O)c1cc2ccncc2cc1O
InChIInChI=1S/C9H8BNO3/c12-9-4-7-5-11-2-1-6(7)3-8(9)10(13)14/h1-5,12-14H
InChIKeyQYOQOBWVCWZPGT-UHFFFAOYSA-N
XLogP-0.38
TPSA73.58 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.98
LogP ≤ 5-0.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (7-hydroxyisoquinolin-6-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (7-hydroxyisoquinolin-6-yl)boronic acid?
The IUPAC name of (7-hydroxyisoquinolin-6-yl)boronic acid (CID 162391465) is (7-hydroxyisoquinolin-6-yl)boronic acid.
What is the SMILES notation for (7-hydroxyisoquinolin-6-yl)boronic acid?
The canonical SMILES for (7-hydroxyisoquinolin-6-yl)boronic acid is OB(O)c1cc2ccncc2cc1O.
What is the InChIKey of (7-hydroxyisoquinolin-6-yl)boronic acid?
The InChIKey is QYOQOBWVCWZPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BNO3/c12-9-4-7-5-11-2-1-6(7)3-8(9)10(13)14/h1-5,12-14H.
What are the key properties of (7-hydroxyisoquinolin-6-yl)boronic acid?
(7-hydroxyisoquinolin-6-yl)boronic acid has a molecular weight of 188.98 g/mol, XLogP of -0.38, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxyisoquinolin-6-yl)boronic acid is sourced from PubChem (CID 162391465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).