C23H28N5O2+ — CID 162392846
tert-butyl 4-(6-benzylpyrido[3,4-b]pyrazin-6-ium-2-yl)piperazine-1-carboxylate (PubChem CID 162392846) has the molecular formula C23H28N5O2+ and a molecular weight of 406.51 g/mol. Its IUPAC name is tert-butyl 4-(6-benzylpyrido[3,4-b]pyrazin-6-ium-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-benzylpyrido[3,4-b]pyrazin-6-ium-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162392846 |
| Molecular Formula | C23H28N5O2+ |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | tert-butyl 4-(6-benzylpyrido[3,4-b]pyrazin-6-ium-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cnc3c[n+](Cc4ccccc4)ccc3n2)CC1 |
| InChI | InChI=1S/C23H28N5O2/c1-23(2,3)30-22(29)28-13-11-27(12-14-28)21-15-24-20-17-26(10-9-19(20)25-21)16-18-7-5-4-6-8-18/h4-10,15,17H,11-14,16H2,1-3H3/q+1 |
| InChIKey | DNTHLZBOKKHPRH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|