C19H22N6O2 — CID 140936839
tert-butyl 4-[6-(6-isocyano-3-pyridinyl)pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 140936839) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is tert-butyl 4-[6-(6-isocyano-3-pyridinyl)pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(6-isocyano-3-pyridinyl)pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140936839 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | tert-butyl 4-[6-(6-isocyano-3-pyridinyl)pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(-c2cncc(N3CCN(C(=O)OC(C)(C)C)CC3)n2)cn1 |
| InChI | InChI=1S/C19H22N6O2/c1-19(2,3)27-18(26)25-9-7-24(8-10-25)17-13-21-12-15(23-17)14-5-6-16(20-4)22-11-14/h5-6,11-13H,7-10H2,1-3H3 |
| InChIKey | MJHISQSGCYYSJP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|