C24H27F3N6O8S — CID 162392997
methyl 2-[(2R,3R,4S,5R,6S)-3-acetyloxy-6-[(3R,4R,5S)-5-azido-4-hydroxyoxan-3-yl]sulfanyl-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]acetate (PubChem CID 162392997) has the molecular formula C24H27F3N6O8S and a molecular weight of 616.58 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S,5R,6S)-3-acetyloxy-6-[(3R,4R,5S)-5-azido-4-hydroxyoxan-3-yl]sulfanyl-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S,5R,6S)-3-acetyloxy-6-[(3R,4R,5S)-5-azido-4-hydroxyoxan-3-yl]sulfanyl-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 162392997 |
| Molecular Formula | C24H27F3N6O8S |
| Molecular Weight | 616.58 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | methyl 2-[(2R,3R,4S,5R,6S)-3-acetyloxy-6-[(3R,4R,5S)-5-azido-4-hydroxyoxan-3-yl]sulfanyl-5-methoxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@@H](S[C@@H]2COC[C@H](N=[N+]=[N-])[C@H]2O)[C@H](OC)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H27F3N6O8S/c1-10(34)40-22-16(6-18(35)37-2)41-24(42-17-9-39-8-15(21(17)36)29-31-28)23(38-3)20(22)33-7-14(30-32-33)11-4-12(25)19(27)13(26)5-11/h4-5,7,15-17,20-24,36H,6,8-9H2,1-3H3/t15-,16+,17+,20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | BGMYBNJZODXMFQ-CNXOOLSUSA-N |
| XLogP | 2.31 |
| TPSA | 179.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|