C18H21N3O2S2 — CID 162395574
N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-2-morpholin-4-yl-2-sulfanylideneacetamide (PubChem CID 162395574) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-2-morpholin-4-yl-2-sulfanylideneacetamide.
| Compound Name | N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-2-morpholin-4-yl-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 162395574 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-2-morpholin-4-yl-2-sulfanylideneacetamide |
| SMILES | CCc1ccc(Cc2cnc(NC(=O)C(=S)N3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C18H21N3O2S2/c1-2-13-3-5-14(6-4-13)11-15-12-19-18(25-15)20-16(22)17(24)21-7-9-23-10-8-21/h3-6,12H,2,7-11H2,1H3,(H,19,20,22) |
| InChIKey | JSOUMLFQUPCYTI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|