C18H11F6N3OS — CID 162395917
2-[2-(trifluoromethyl)anilino]-5-[[2-(trifluoromethyl)phenyl]iminomethyl]-1,3-thiazol-4-ol (PubChem CID 162395917) has the molecular formula C18H11F6N3OS and a molecular weight of 431.36 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)anilino]-5-[[2-(trifluoromethyl)phenyl]iminomethyl]-1,3-thiazol-4-ol.
| Compound Name | 2-[2-(trifluoromethyl)anilino]-5-[[2-(trifluoromethyl)phenyl]iminomethyl]-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 162395917 |
| Molecular Formula | C18H11F6N3OS |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-[2-(trifluoromethyl)anilino]-5-[[2-(trifluoromethyl)phenyl]iminomethyl]-1,3-thiazol-4-ol |
| SMILES | Oc1nc(Nc2ccccc2C(F)(F)F)sc1/C=N/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H11F6N3OS/c19-17(20,21)10-5-1-3-7-12(10)25-9-14-15(28)27-16(29-14)26-13-8-4-2-6-11(13)18(22,23)24/h1-9,28H,(H,26,27)/b25-9+ |
| InChIKey | AYSNFFIFIYUFGJ-YCPBAFNGSA-N |
| XLogP | 6.38 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|