C13H13N3O3S — CID 137249091
N-[4-hydroxy-5-[(2-methoxyphenyl)iminomethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 137249091) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is N-[4-hydroxy-5-[(2-methoxyphenyl)iminomethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-hydroxy-5-[(2-methoxyphenyl)iminomethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 137249091 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[4-hydroxy-5-[(2-methoxyphenyl)iminomethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccccc1/N=C/c1sc(NC(C)=O)nc1O |
| InChI | InChI=1S/C13H13N3O3S/c1-8(17)15-13-16-12(18)11(20-13)7-14-9-5-3-4-6-10(9)19-2/h3-7,18H,1-2H3,(H,15,16,17)/b14-7+ |
| InChIKey | TUWZBWRAWAFELC-VGOFMYFVSA-N |
| XLogP | 2.57 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|