C26H46O4Si — CID 162396992
ethyl (E)-3-[(1S,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentyl]prop-2-enoate (PubChem CID 162396992) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is ethyl (E)-3-[(1S,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentyl]prop-2-enoate |
|---|---|
| PubChem CID | 162396992 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | ethyl (E)-3-[(1S,2S)-4,4-dimethyl-2-[(1R,3S)-1-methyl-2-oxo-3-tri(propan-2-yl)silyloxycyclobutyl]cyclopentyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1CC(C)(C)C[C@@H]1[C@@]1(C)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C26H46O4Si/c1-11-29-23(27)13-12-20-14-25(8,9)15-21(20)26(10)16-22(24(26)28)30-31(17(2)3,18(4)5)19(6)7/h12-13,17-22H,11,14-16H2,1-10H3/b13-12+/t20-,21+,22+,26-/m1/s1 |
| InChIKey | RZXLDQBKVPYRAM-CUJCCKOJSA-N |
| XLogP | 6.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|