C20H26N2O8 — CID 162397091
dimethyl 1-oxo-8-(3,4,5-trimethoxyphenyl)-3,5,7,8-tetrahydro-2H-pyrazolo[1,2-a]pyridazine-6,6-dicarboxylate (PubChem CID 162397091) has the molecular formula C20H26N2O8 and a molecular weight of 422.43 g/mol. Its IUPAC name is dimethyl 1-oxo-8-(3,4,5-trimethoxyphenyl)-3,5,7,8-tetrahydro-2H-pyrazolo[1,2-a]pyridazine-6,6-dicarboxylate.
| Compound Name | dimethyl 1-oxo-8-(3,4,5-trimethoxyphenyl)-3,5,7,8-tetrahydro-2H-pyrazolo[1,2-a]pyridazine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 162397091 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | dimethyl 1-oxo-8-(3,4,5-trimethoxyphenyl)-3,5,7,8-tetrahydro-2H-pyrazolo[1,2-a]pyridazine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2cc(OC)c(OC)c(OC)c2)N2C(=O)CCN2C1 |
| InChI | InChI=1S/C20H26N2O8/c1-26-14-8-12(9-15(27-2)17(14)28-3)13-10-20(18(24)29-4,19(25)30-5)11-21-7-6-16(23)22(13)21/h8-9,13H,6-7,10-11H2,1-5H3 |
| InChIKey | NWMRTZUXDJQIJM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|