C20H23F3N2O8 — CID 71601911
dimethyl (5R,7S)-3-oxo-5-(trifluoromethyl)-7-(3,4,5-trimethoxyphenyl)-1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,6-dicarboxylate (PubChem CID 71601911) has the molecular formula C20H23F3N2O8 and a molecular weight of 476.40 g/mol. Its IUPAC name is dimethyl (5R,7S)-3-oxo-5-(trifluoromethyl)-7-(3,4,5-trimethoxyphenyl)-1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,6-dicarboxylate.
| Compound Name | dimethyl (5R,7S)-3-oxo-5-(trifluoromethyl)-7-(3,4,5-trimethoxyphenyl)-1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 71601911 |
| Molecular Formula | C20H23F3N2O8 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | dimethyl (5R,7S)-3-oxo-5-(trifluoromethyl)-7-(3,4,5-trimethoxyphenyl)-1,2,5,7-tetrahydropyrazolo[1,2-a]pyrazole-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@H](c2cc(OC)c(OC)c(OC)c2)N2CCC(=O)N2[C@H]1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O8/c1-29-11-8-10(9-12(30-2)14(11)31-3)15-19(17(27)32-4,18(28)33-5)16(20(21,22)23)25-13(26)6-7-24(15)25/h8-9,15-16H,6-7H2,1-5H3/t15-,16+/m0/s1 |
| InChIKey | FSEHSRKLYKGZFV-JKSUJKDBSA-N |
| XLogP | 1.48 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|