C12H6ClFI2S — CID 162397535
1-(4-chlorophenyl)sulfanyl-5-fluoro-2,3-diiodobenzene (PubChem CID 162397535) has the molecular formula C12H6ClFI2S and a molecular weight of 490.51 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfanyl-5-fluoro-2,3-diiodobenzene.
| Compound Name | 1-(4-chlorophenyl)sulfanyl-5-fluoro-2,3-diiodobenzene |
|---|---|
| PubChem CID | 162397535 |
| Molecular Formula | C12H6ClFI2S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 489.80 |
| IUPAC Name | 1-(4-chlorophenyl)sulfanyl-5-fluoro-2,3-diiodobenzene |
| SMILES | Fc1cc(I)c(I)c(Sc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C12H6ClFI2S/c13-7-1-3-9(4-2-7)17-11-6-8(14)5-10(15)12(11)16/h1-6H |
| InChIKey | UTVJDQKQXCTLAS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|