C20H24O6 — CID 162397708
trans-trimethyl (3R,4S)-3-methyl-4-(1-phenylethenyl)cyclopentane-1,1,3-tricarboxylate (PubChem CID 162397708) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is trans-trimethyl (3R,4S)-3-methyl-4-(1-phenylethenyl)cyclopentane-1,1,3-tricarboxylate.
| Compound Name | trans-trimethyl (3R,4S)-3-methyl-4-(1-phenylethenyl)cyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 162397708 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | trans-trimethyl (3R,4S)-3-methyl-4-(1-phenylethenyl)cyclopentane-1,1,3-tricarboxylate |
| SMILES | C=C(c1ccccc1)[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@@]1(C)C(=O)OC |
| InChI | InChI=1S/C20H24O6/c1-13(14-9-7-6-8-10-14)15-11-20(17(22)25-4,18(23)26-5)12-19(15,2)16(21)24-3/h6-10,15H,1,11-12H2,2-5H3/t15-,19+/m0/s1 |
| InChIKey | YODNVHLFDBAGID-HNAYVOBHSA-N |
| XLogP | 2.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|