C25H25N3O2 — CID 162397788
ethyl 4-(8,16-dimethyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)benzoate (PubChem CID 162397788) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 4-(8,16-dimethyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)benzoate.
| Compound Name | ethyl 4-(8,16-dimethyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)benzoate |
|---|---|
| PubChem CID | 162397788 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 4-(8,16-dimethyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C3c4ccccc4N(C)C2c2ccccc2N3C)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-4-30-25(29)17-13-15-18(16-14-17)28-23-20-10-6-8-12-22(20)27(3)24(28)19-9-5-7-11-21(19)26(23)2/h5-16,23-24H,4H2,1-3H3 |
| InChIKey | ZNPYTUZGMLGJIQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |