C19H24 — CID 162398047
(4R)-1-methyl-4-phenyl-5-propan-2-ylbicyclo[3.2.2]nona-2,6-diene (PubChem CID 162398047) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is (4R)-1-methyl-4-phenyl-5-propan-2-ylbicyclo[3.2.2]nona-2,6-diene.
| Compound Name | (4R)-1-methyl-4-phenyl-5-propan-2-ylbicyclo[3.2.2]nona-2,6-diene |
|---|---|
| PubChem CID | 162398047 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (4R)-1-methyl-4-phenyl-5-propan-2-ylbicyclo[3.2.2]nona-2,6-diene |
| SMILES | CC(C)C12C=CC(C)(C=C[C@@H]1c1ccccc1)CC2 |
| InChI | InChI=1S/C19H24/c1-15(2)19-13-11-18(3,12-14-19)10-9-17(19)16-7-5-4-6-8-16/h4-11,13,15,17H,12,14H2,1-3H3/t17-,18?,19?/m1/s1 |
| InChIKey | RIHPKCVNJXBWAH-LMDPOFIKSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|