C25H27NO2 — CID 102043649
(5R,10R)-2,2-dimethyl-10-phenyl-7-[(1S)-1-phenylethyl]-7-azaspiro[4.5]dec-8-ene-4,6-dione (PubChem CID 102043649) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (5R,10R)-2,2-dimethyl-10-phenyl-7-[(1S)-1-phenylethyl]-7-azaspiro[4.5]dec-8-ene-4,6-dione.
| Compound Name | (5R,10R)-2,2-dimethyl-10-phenyl-7-[(1S)-1-phenylethyl]-7-azaspiro[4.5]dec-8-ene-4,6-dione |
|---|---|
| PubChem CID | 102043649 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (5R,10R)-2,2-dimethyl-10-phenyl-7-[(1S)-1-phenylethyl]-7-azaspiro[4.5]dec-8-ene-4,6-dione |
| SMILES | C[C@@H](c1ccccc1)N1C=C[C@H](c2ccccc2)[C@@]2(CC(C)(C)CC2=O)C1=O |
| InChI | InChI=1S/C25H27NO2/c1-18(19-10-6-4-7-11-19)26-15-14-21(20-12-8-5-9-13-20)25(23(26)28)17-24(2,3)16-22(25)27/h4-15,18,21H,16-17H2,1-3H3/t18-,21+,25+/m0/s1 |
| InChIKey | DRMLNMSEEAKCSB-NXQMDHLFSA-N |
| XLogP | 5.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|