C13H13NO — CID 162398530
(3aR)-3a-methyl-2-methylidene-3,4-dihydropyrrolo[1,2-a]indol-1-one (PubChem CID 162398530) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (3aR)-3a-methyl-2-methylidene-3,4-dihydropyrrolo[1,2-a]indol-1-one.
| Compound Name | (3aR)-3a-methyl-2-methylidene-3,4-dihydropyrrolo[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 162398530 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (3aR)-3a-methyl-2-methylidene-3,4-dihydropyrrolo[1,2-a]indol-1-one |
| SMILES | C=C1C[C@@]2(C)Cc3ccccc3N2C1=O |
| InChI | InChI=1S/C13H13NO/c1-9-7-13(2)8-10-5-3-4-6-11(10)14(13)12(9)15/h3-6H,1,7-8H2,2H3/t13-/m0/s1 |
| InChIKey | HLGGQPXDVXKKLW-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|