C25H36N2O — CID 159480286
1-(1-cyclooctyl-4-methylpiperidin-4-yl)-2-methylidene-5H-1-benzazepin-4-one (PubChem CID 159480286) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 1-(1-cyclooctyl-4-methylpiperidin-4-yl)-2-methylidene-5H-1-benzazepin-4-one.
| Compound Name | 1-(1-cyclooctyl-4-methylpiperidin-4-yl)-2-methylidene-5H-1-benzazepin-4-one |
|---|---|
| PubChem CID | 159480286 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 1-(1-cyclooctyl-4-methylpiperidin-4-yl)-2-methylidene-5H-1-benzazepin-4-one |
| SMILES | C=C1CC(=O)Cc2ccccc2N1C1(C)CCN(C2CCCCCCC2)CC1 |
| InChI | InChI=1S/C25H36N2O/c1-20-18-23(28)19-21-10-8-9-13-24(21)27(20)25(2)14-16-26(17-15-25)22-11-6-4-3-5-7-12-22/h8-10,13,22H,1,3-7,11-12,14-19H2,2H3 |
| InChIKey | BFWCBFWKUHXHTQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |