C24H29FO5 — CID 162398862
methyl (5S)-5-[6-[(E,3R,4S)-5-(4-fluorophenyl)-3,4-dihydroxypent-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate (PubChem CID 162398862) has the molecular formula C24H29FO5 and a molecular weight of 416.49 g/mol. Its IUPAC name is methyl (5S)-5-[6-[(E,3R,4S)-5-(4-fluorophenyl)-3,4-dihydroxypent-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate.
| Compound Name | methyl (5S)-5-[6-[(E,3R,4S)-5-(4-fluorophenyl)-3,4-dihydroxypent-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate |
|---|---|
| PubChem CID | 162398862 |
| Molecular Formula | C24H29FO5 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | methyl (5S)-5-[6-[(E,3R,4S)-5-(4-fluorophenyl)-3,4-dihydroxypent-1-enyl]cyclohepta-1,3,5-trien-1-yl]-5-hydroxypentanoate |
| SMILES | COC(=O)CCC[C@H](O)C1=CC=CC=C(/C=C/[C@@H](O)[C@@H](O)Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H29FO5/c1-30-24(29)8-4-7-21(26)19-6-3-2-5-17(15-19)11-14-22(27)23(28)16-18-9-12-20(25)13-10-18/h2-3,5-6,9-14,21-23,26-28H,4,7-8,15-16H2,1H3/b14-11+/t21-,22+,23-/m0/s1 |
| InChIKey | VEIXEWIQMWFSKJ-WYPXKNDESA-N |
| XLogP | 3.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |