C22H24N2O2 — CID 162400551
tert-butyl N-[(1R)-1-isoquinolin-1-yl-2-phenylethyl]carbamate (PubChem CID 162400551) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-isoquinolin-1-yl-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-isoquinolin-1-yl-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 162400551 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | tert-butyl N-[(1R)-1-isoquinolin-1-yl-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)c1nccc2ccccc12 |
| InChI | InChI=1S/C22H24N2O2/c1-22(2,3)26-21(25)24-19(15-16-9-5-4-6-10-16)20-18-12-8-7-11-17(18)13-14-23-20/h4-14,19H,15H2,1-3H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | BSGXCONZIHTRDY-LJQANCHMSA-N |
| XLogP | 5.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |