C29H33NO4S — CID 162401505
benzyl (2R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-phenylpropanoate (PubChem CID 162401505) has the molecular formula C29H33NO4S and a molecular weight of 491.65 g/mol. Its IUPAC name is benzyl (2R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-phenylpropanoate.
| Compound Name | benzyl (2R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-phenylpropanoate |
|---|---|
| PubChem CID | 162401505 |
| Molecular Formula | C29H33NO4S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | benzyl (2R)-3-[4-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C)(C[C@@H](C(=O)OCc3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H33NO4S/c1-23-13-15-26(16-14-23)35(32,33)30-19-17-29(2,18-20-30)21-27(25-11-7-4-8-12-25)28(31)34-22-24-9-5-3-6-10-24/h3-16,27H,17-22H2,1-2H3/t27-/m1/s1 |
| InChIKey | ZKIOZDTWHHQQSC-HHHXNRCGSA-N |
| XLogP | 5.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |