C22H27Cl2NO3S — CID 162401849
4-[4-(2,6-dichlorophenoxy)butyl]-1-(4-methylphenyl)sulfonylpiperidine (PubChem CID 162401849) has the molecular formula C22H27Cl2NO3S and a molecular weight of 456.44 g/mol. Its IUPAC name is 4-[4-(2,6-dichlorophenoxy)butyl]-1-(4-methylphenyl)sulfonylpiperidine.
| Compound Name | 4-[4-(2,6-dichlorophenoxy)butyl]-1-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 162401849 |
| Molecular Formula | C22H27Cl2NO3S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-[4-(2,6-dichlorophenoxy)butyl]-1-(4-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(CCCCOc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H27Cl2NO3S/c1-17-8-10-19(11-9-17)29(26,27)25-14-12-18(13-15-25)5-2-3-16-28-22-20(23)6-4-7-21(22)24/h4,6-11,18H,2-3,5,12-16H2,1H3 |
| InChIKey | VTTVJHXNTINSMP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|