C16H12F2NO4RhS- — CID 162401865
(4,4-difluoro-1-oxo-3H-isoquinolin-2-id-3-yl) 4-methylbenzenesulfonate;rhodium (PubChem CID 162401865) has the molecular formula C16H12F2NO4RhS- and a molecular weight of 455.24 g/mol. Its IUPAC name is (4,4-difluoro-1-oxo-3H-isoquinolin-2-id-3-yl) 4-methylbenzenesulfonate;rhodium.
| Compound Name | (4,4-difluoro-1-oxo-3H-isoquinolin-2-id-3-yl) 4-methylbenzenesulfonate;rhodium |
|---|---|
| PubChem CID | 162401865 |
| Molecular Formula | C16H12F2NO4RhS- |
| Molecular Weight | 455.24 g/mol |
| Exact Mass | 454.95 |
| IUPAC Name | (4,4-difluoro-1-oxo-3H-isoquinolin-2-id-3-yl) 4-methylbenzenesulfonate;rhodium |
| SMILES | Cc1ccc(S(=O)(=O)OC2[N-]C(=O)c3ccccc3C2(F)F)cc1.[Rh] |
| InChI | InChI=1S/C16H13F2NO4S.Rh/c1-10-6-8-11(9-7-10)24(21,22)23-15-16(17,18)13-5-3-2-4-12(13)14(20)19-15;/h2-9,15H,1H3,(H,19,20);/p-1 |
| InChIKey | IMFFBWDCMDGJHB-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|