C15H16O3 — CID 162402621
(6aR)-3,6,9-trimethyl-5,6,6a,7-tetrahydroazuleno[4,5-b]furan-4,8-dione (PubChem CID 162402621) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (6aR)-3,6,9-trimethyl-5,6,6a,7-tetrahydroazuleno[4,5-b]furan-4,8-dione.
| Compound Name | (6aR)-3,6,9-trimethyl-5,6,6a,7-tetrahydroazuleno[4,5-b]furan-4,8-dione |
|---|---|
| PubChem CID | 162402621 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (6aR)-3,6,9-trimethyl-5,6,6a,7-tetrahydroazuleno[4,5-b]furan-4,8-dione |
| SMILES | CC1=C2c3occ(C)c3C(=O)CC(C)[C@H]2CC1=O |
| InChI | InChI=1S/C15H16O3/c1-7-4-12(17)13-8(2)6-18-15(13)14-9(3)11(16)5-10(7)14/h6-7,10H,4-5H2,1-3H3/t7?,10-/m1/s1 |
| InChIKey | CLAPLFAABVVYOH-OMNKOJBGSA-N |
| XLogP | 3.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |