C20H23NO6 — CID 162402981
[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl)methanone (PubChem CID 162402981) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl)methanone.
| Compound Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl)methanone |
|---|---|
| PubChem CID | 162402981 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-(2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl)methanone |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)N3OC4C=CC3C4)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H23NO6/c1-20(2)25-17-15(23-11-12-6-4-3-5-7-12)16(24-19(17)26-20)18(22)21-13-8-9-14(10-13)27-21/h3-9,13-17,19H,10-11H2,1-2H3/t13?,14?,15-,16-,17+,19+/m0/s1 |
| InChIKey | FHFMZQRODFXHBR-KNAOHXEWSA-N |
| XLogP | 1.92 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|