C21H29NO4 — CID 10832316
(2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-1-pyrrolidin-1-ylpent-4-en-1-one (PubChem CID 10832316) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-1-pyrrolidin-1-ylpent-4-en-1-one.
| Compound Name | (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-1-pyrrolidin-1-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 10832316 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxy-1-pyrrolidin-1-ylpent-4-en-1-one |
| SMILES | C=C[C@H]([C@H]1COC(C)(C)O1)[C@@H](OCc1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H29NO4/c1-4-17(18-15-25-21(2,3)26-18)19(20(23)22-12-8-9-13-22)24-14-16-10-6-5-7-11-16/h4-7,10-11,17-19H,1,8-9,12-15H2,2-3H3/t17-,18-,19-/m1/s1 |
| InChIKey | HSFMUCZGUIANRX-GUDVDZBRSA-N |
| XLogP | 3.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|