C23H25NO5 — CID 10715706
(1R,2R,6S,9S)-4,4-dimethyl-9-phenyl-1-(phenylmethoxymethyl)-3,5,11-trioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 10715706) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (1R,2R,6S,9S)-4,4-dimethyl-9-phenyl-1-(phenylmethoxymethyl)-3,5,11-trioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1R,2R,6S,9S)-4,4-dimethyl-9-phenyl-1-(phenylmethoxymethyl)-3,5,11-trioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 10715706 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (1R,2R,6S,9S)-4,4-dimethyl-9-phenyl-1-(phenylmethoxymethyl)-3,5,11-trioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | CC1(C)O[C@@H]2C(=O)N3[C@@H](c4ccccc4)CO[C@]3(COCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C23H25NO5/c1-22(2)28-19-20(29-22)23(15-26-13-16-9-5-3-6-10-16)24(21(19)25)18(14-27-23)17-11-7-4-8-12-17/h3-12,18-20H,13-15H2,1-2H3/t18-,19+,20-,23-/m1/s1 |
| InChIKey | AMZIWNHHSRRATM-VLVHOKLOSA-N |
| XLogP | 3.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |