C21H19NO2Y-2 — CID 162403165
benzyl 1-buta-1,3-dien-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate;yttrium (PubChem CID 162403165) has the molecular formula C21H19NO2Y-2 and a molecular weight of 406.29 g/mol. Its IUPAC name is benzyl 1-buta-1,3-dien-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate;yttrium.
| Compound Name | benzyl 1-buta-1,3-dien-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate;yttrium |
|---|---|
| PubChem CID | 162403165 |
| Molecular Formula | C21H19NO2Y-2 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | benzyl 1-buta-1,3-dien-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate;yttrium |
| SMILES | [H]/[C-]=C(/C=[C-]/[H])C1c2ccccc2CCN1C(=O)OCc1ccccc1.[Y] |
| InChI | InChI=1S/C21H19NO2.Y/c1-3-16(2)20-19-12-8-7-11-18(19)13-14-22(20)21(23)24-15-17-9-5-4-6-10-17;/h1-12,20H,13-15H2;/q-2; |
| InChIKey | WMTQHYFUDOCWBN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|