C27H24N2O3S — CID 162403629
8-(4-methylphenyl)sulfonyl-12-(N-prop-2-ynylanilino)-8-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-one (PubChem CID 162403629) has the molecular formula C27H24N2O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 8-(4-methylphenyl)sulfonyl-12-(N-prop-2-ynylanilino)-8-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-one.
| Compound Name | 8-(4-methylphenyl)sulfonyl-12-(N-prop-2-ynylanilino)-8-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 162403629 |
| Molecular Formula | C27H24N2O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 8-(4-methylphenyl)sulfonyl-12-(N-prop-2-ynylanilino)-8-azatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-one |
| SMILES | C#CCN(c1ccccc1)C1C2C(=O)CC1N(S(=O)(=O)c1ccc(C)cc1)c1ccccc12 |
| InChI | InChI=1S/C27H24N2O3S/c1-3-17-28(20-9-5-4-6-10-20)27-24-18-25(30)26(27)22-11-7-8-12-23(22)29(24)33(31,32)21-15-13-19(2)14-16-21/h1,4-16,24,26-27H,17-18H2,2H3 |
| InChIKey | CSMLJIHKXAWKHI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|