C33H20N4O3 — CID 162403713
(4-nitrophenyl)-[(1R,2S,3R)-3-quinolin-2-ylspiro[cyclopropane-2,11'-indeno[1,2-b]quinoxaline]-1-yl]methanone (PubChem CID 162403713) has the molecular formula C33H20N4O3 and a molecular weight of 520.55 g/mol. Its IUPAC name is (4-nitrophenyl)-[(1R,2S,3R)-3-quinolin-2-ylspiro[cyclopropane-2,11'-indeno[1,2-b]quinoxaline]-1-yl]methanone.
| Compound Name | (4-nitrophenyl)-[(1R,2S,3R)-3-quinolin-2-ylspiro[cyclopropane-2,11'-indeno[1,2-b]quinoxaline]-1-yl]methanone |
|---|---|
| PubChem CID | 162403713 |
| Molecular Formula | C33H20N4O3 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | (4-nitrophenyl)-[(1R,2S,3R)-3-quinolin-2-ylspiro[cyclopropane-2,11'-indeno[1,2-b]quinoxaline]-1-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)[C@@H]1[C@@H](c2ccc3ccccc3n2)[C@@]12c1ccccc1-c1nc3ccccc3nc12 |
| InChI | InChI=1S/C33H20N4O3/c38-31(20-13-16-21(17-14-20)37(39)40)29-28(27-18-15-19-7-1-4-10-24(19)34-27)33(29)23-9-3-2-8-22(23)30-32(33)36-26-12-6-5-11-25(26)35-30/h1-18,28-29H/t28-,29+,33+/m1/s1 |
| InChIKey | QXRPWSDILZHOBB-NCXRXOCASA-N |
| XLogP | 6.65 |
| TPSA | 98.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|