C40H29N3O3 — CID 124715183
[(1R,2R,3R,3aR)-1-(4-nitrophenyl)-2-phenyl-4-quinolin-2-yl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone (PubChem CID 124715183) has the molecular formula C40H29N3O3 and a molecular weight of 599.69 g/mol. Its IUPAC name is [(1R,2R,3R,3aR)-1-(4-nitrophenyl)-2-phenyl-4-quinolin-2-yl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone.
| Compound Name | [(1R,2R,3R,3aR)-1-(4-nitrophenyl)-2-phenyl-4-quinolin-2-yl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 124715183 |
| Molecular Formula | C40H29N3O3 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | [(1R,2R,3R,3aR)-1-(4-nitrophenyl)-2-phenyl-4-quinolin-2-yl-1,2,3,3a-tetrahydropyrrolo[1,2-a]quinolin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](c2ccccc2)[C@H](c2ccc([N+](=O)[O-])cc2)N2c3ccccc3C=C(c3ccc4ccccc4n3)[C@@H]12 |
| InChI | InChI=1S/C40H29N3O3/c44-40(29-14-5-2-6-15-29)37-36(27-12-3-1-4-13-27)38(28-19-22-31(23-20-28)43(45)46)42-35-18-10-8-16-30(35)25-32(39(37)42)34-24-21-26-11-7-9-17-33(26)41-34/h1-25,36-39H/t36-,37+,38-,39-/m0/s1 |
| InChIKey | NYXWOKXMYHHPEP-XERMPXOXSA-N |
| XLogP | 8.91 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|